Кофермент A: различия между версиями

381 байт добавлено ,  8 лет назад
Нет описания правки
м (Перемещение 22 интервики-ссылок в Викиданные (d:Q407635))
| картинка3D = Coenzyme-A-3D-balls.png
| картинка малая =
| наименование = [(2R,3S,4R,5R)-5-(6-аминопурин-9-ил)-4-гидрокси-3-фосфонооксиоксолан-2-ил]метил-дифосфат-[(3R)-3-гидрокси-2,2-диметил-4-оксо-4-[[3-оксо-3-(2-сульфанилэтиламино)пропил]амино]бутокси]
| наименование =
| традиционные названия = Коэнзим-А
| сокращения =
| хим. формула = C<sub>21</sub>H<sub>36</sub>N<sub>7</sub>O<sub>16</sub>P<sub>3</sub>S
| эмпирическая формула = C<sub>21</sub> 32,86 %, H<sub>36</sub> 4,73 %, N<sub>7</sub> 12,77 %, O<sub>16</sub> 33,35 %, P<sub>3</sub> 12,11 %, S 4,18 %
| отн. молек. масса = 767,535534 ± 0,031
| молярная масса = 767,535534 ± 0,031
 
| плотность =
 
| CAS = 85-61-0
| EINECS PubChem = 68163312
| SMILES = O=C(NCCS)CCNC(=O)C(O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n2cnc1c(ncnc12)N)[C@H](O)[C@@H]3OP(=O)(O)O
| ЕС =