Меркурохром: различия между версиями

м
автоматическое удаление устаревших параметров карточки {{Вещество}}
м (Перемещение 1 интервики на Викиданные, d:Q419070)
м (автоматическое удаление устаревших параметров карточки {{Вещество}})
| сокращения = <!-- принятые сокращения названия -->
| хим. формула = <!-- например: С{{sub|2}}H{{sub|5}}(OH){{sub|2}} -->
| рац. формула = <!-- формула, отображающая помимо всего прочего строение вещества -->C{{sub|20}}H{{sub|8}}Br{{sub|2}}HgNa{{sub|2}}O{{sub|6}}
| эмпирическая формула = C{{sub|20}}H{{sub|8}}Br{{sub|2}}HgNa{{sub|2}}O{{sub|6}}
 
| состояние = тёмно-зелёные кристаллы
| примеси = <!-- типичное кол-во, указать единицы -->
| молярная концентрация = <!-- число, в моль/л -->
| отн. молек. масса = <!-- число, в а.е.м. -->
 
| молярная масса = 750,65
| плотность = <!-- число, в г/см³ -->
| энтальпия сублимации = <!-- число, в кДж/моль -->
| удельная теплота парообразования = <!-- число, в Дж/кг -->
| удельная теплота парообразования2= <!-- число, размерность -->
| удельная теплота плавления = <!-- число, в Дж/кг -->
| удельная теплота плавления2 = <!-- число, размерность -->
| тепловое расширение = <!-- число (безразм.) -->
| интервал трансформации = <!-- число, в ° -->
| EINECS = <!-- № по EINECS -->
| SMILES = [Na+].[Na+].[O-]C(=O)c4ccccc4C=1c3cc(Br)c([O-])c([Hg]O)c3O/C/2=C/C(=O)C(/Br)=C\C=1\2
| Номер UN = <!-- № по UN -->
| ЕС = 204-933-6
| RTECS = <!-- № по RTECS -->
21 949

правок